Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Barium carbonate, 99+%
CAS: 513-77-9 Molecular Formula: CBaO3 Molecular Weight (g/mol): 197.34 MDL Number: MFCD00003448 InChI Key: AYJRCSIUFZENHW-UHFFFAOYSA-L Synonym: barium carbonate,carbonic acid, barium salt 1:1,barium carbonate 1:1,barium monocarbonate,carbonic acid, barium salt,pigment white 10,caswell no. 069,witherite,ci pigment white 10,bw-p PubChem CID: 10563 SMILES: [Ba++].[O-]C([O-])=O
| PubChem CID | 10563 |
|---|---|
| CAS | 513-77-9 |
| Molecular Weight (g/mol) | 197.34 |
| MDL Number | MFCD00003448 |
| SMILES | [Ba++].[O-]C([O-])=O |
| Synonym | barium carbonate,carbonic acid, barium salt 1:1,barium carbonate 1:1,barium monocarbonate,carbonic acid, barium salt,pigment white 10,caswell no. 069,witherite,ci pigment white 10,bw-p |
| InChI Key | AYJRCSIUFZENHW-UHFFFAOYSA-L |
| Molecular Formula | CBaO3 |
Terbium(III) chloride, anhydrous, 99.9% (REO)
CAS: 10042-88-3 Molecular Formula: Cl3Tb Molecular Weight (g/mol): 265.28 MDL Number: MFCD00011258 InChI Key: GFISHBQNVWAVFU-UHFFFAOYSA-K IUPAC Name: trichloroterbium SMILES: Cl[Tb](Cl)Cl
| CAS | 10042-88-3 |
|---|---|
| Molecular Weight (g/mol) | 265.28 |
| MDL Number | MFCD00011258 |
| SMILES | Cl[Tb](Cl)Cl |
| IUPAC Name | trichloroterbium |
| InChI Key | GFISHBQNVWAVFU-UHFFFAOYSA-K |
| Molecular Formula | Cl3Tb |
Sodium glucoheptonate
CAS: 31138-65-5 Molecular Formula: C7H13NaO8 Molecular Weight (g/mol): 248.163 MDL Number: MFCD00013425 InChI Key: FMYOMWCQJXWGEN-AXUKCSBQSA-M Synonym: sodium glucoheptonate,sodium 2r,3r,4r,5s,6r-2,3,4,5,6,7-hexahydroxyheptanoate,d-sodium glucoheptonate,sodium-alpha-glucoheptonate,2r,3r,4r,5s,6r-2,3,4,5,6,7-hexahydroxyheptanoic acid sodium salt PubChem CID: 49853507 IUPAC Name: sodium;(2R,3R,4R,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoate SMILES: C(C(C(C(C(C(C(=O)[O-])O)O)O)O)O)O.[Na+]
| PubChem CID | 49853507 |
|---|---|
| CAS | 31138-65-5 |
| Molecular Weight (g/mol) | 248.163 |
| MDL Number | MFCD00013425 |
| SMILES | C(C(C(C(C(C(C(=O)[O-])O)O)O)O)O)O.[Na+] |
| Synonym | sodium glucoheptonate,sodium 2r,3r,4r,5s,6r-2,3,4,5,6,7-hexahydroxyheptanoate,d-sodium glucoheptonate,sodium-alpha-glucoheptonate,2r,3r,4r,5s,6r-2,3,4,5,6,7-hexahydroxyheptanoic acid sodium salt |
| IUPAC Name | sodium;(2R,3R,4R,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoate |
| InChI Key | FMYOMWCQJXWGEN-AXUKCSBQSA-M |
| Molecular Formula | C7H13NaO8 |
(3-Glycidoxypropyl)trimethoxysilane, 97%
CAS: 2530-83-8 Molecular Formula: C9H20O5Si Molecular Weight (g/mol): 236.339 MDL Number: MFCD00005144 InChI Key: BPSIOYPQMFLKFR-UHFFFAOYSA-N Synonym: 3-glycidoxypropyltrimethoxysilane,3-glycidoxypropyl trimethoxysilane,glymo,silicone kbm 403,silane a 187,union carbide a-187,silan a 187,silane z 6040,silane-y-4087,3-glycidyloxypropyltrimethoxysilane PubChem CID: 17317 IUPAC Name: trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane SMILES: CO[Si](CCCOCC1CO1)(OC)OC
| PubChem CID | 17317 |
|---|---|
| CAS | 2530-83-8 |
| Molecular Weight (g/mol) | 236.339 |
| MDL Number | MFCD00005144 |
| SMILES | CO[Si](CCCOCC1CO1)(OC)OC |
| Synonym | 3-glycidoxypropyltrimethoxysilane,3-glycidoxypropyl trimethoxysilane,glymo,silicone kbm 403,silane a 187,union carbide a-187,silan a 187,silane z 6040,silane-y-4087,3-glycidyloxypropyltrimethoxysilane |
| IUPAC Name | trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
| InChI Key | BPSIOYPQMFLKFR-UHFFFAOYSA-N |
| Molecular Formula | C9H20O5Si |
Calcium chloride, ACS reagent, desiccant
CAS: 10043-52-4 Molecular Formula: CaCl2 Molecular Weight (g/mol): 110.98 InChI Key: UXVMQQNJUSDDNG-UHFFFAOYSA-L Synonym: calcium chloride,calcium dichloride,calcium chloride anhydrous,calcium ii chloride,calciumchloride,caloride,liquical,calcium chloride pellets,isocal,jarcal PubChem CID: 5284359 ChEBI: CHEBI:3312 SMILES: [Cl-].[Cl-].[Ca++]
| PubChem CID | 5284359 |
|---|---|
| CAS | 10043-52-4 |
| Molecular Weight (g/mol) | 110.98 |
| ChEBI | CHEBI:3312 |
| SMILES | [Cl-].[Cl-].[Ca++] |
| Synonym | calcium chloride,calcium dichloride,calcium chloride anhydrous,calcium ii chloride,calciumchloride,caloride,liquical,calcium chloride pellets,isocal,jarcal |
| InChI Key | UXVMQQNJUSDDNG-UHFFFAOYSA-L |
| Molecular Formula | CaCl2 |
Methylmagnesium bromide, 3.2M solution in 2-MeTHF, AcroSeal™
CAS: 75-16-1 Molecular Formula: CH3BrMg Molecular Weight (g/mol): 119.24 MDL Number: MFCD00000041 InChI Key: AVFUHBJCUUTGCD-UHFFFAOYSA-M Synonym: methylmagnesium bromide,methyl magnesium bromide,magnesium, bromomethyl,bromo methyl magnesium,methylmagnesium bromide solution, 3.0 m in diethyl ether,unii-22cw9773df,memgbr,methymagnesiumbromide,ch3mgbr,methylmagnesiumbromide,grignard reagent PubChem CID: 6349 SMILES: C[Mg]Br
| PubChem CID | 6349 |
|---|---|
| CAS | 75-16-1 |
| Molecular Weight (g/mol) | 119.24 |
| MDL Number | MFCD00000041 |
| SMILES | C[Mg]Br |
| Synonym | methylmagnesium bromide,methyl magnesium bromide,magnesium, bromomethyl,bromo methyl magnesium,methylmagnesium bromide solution, 3.0 m in diethyl ether,unii-22cw9773df,memgbr,methymagnesiumbromide,ch3mgbr,methylmagnesiumbromide,grignard reagent |
| InChI Key | AVFUHBJCUUTGCD-UHFFFAOYSA-M |
| Molecular Formula | CH3BrMg |
Iridium wire, 0.5mm (0.02in) dia, 99.8% (metals basis)
CAS: 7439-88-5 Molecular Formula: Ir Molecular Weight (g/mol): 192.22 MDL Number: MFCD00011062 InChI Key: GKOZUEZYRPOHIO-UHFFFAOYSA-N Synonym: ion,black,metallicum,iridium, elemental,iridium, ion ir4,iridio,hydrido-iridium,atom,powder,sponge PubChem CID: 23924 ChEBI: CHEBI:49666 IUPAC Name: iridium SMILES: [Ir]
| PubChem CID | 23924 |
|---|---|
| CAS | 7439-88-5 |
| Molecular Weight (g/mol) | 192.22 |
| ChEBI | CHEBI:49666 |
| MDL Number | MFCD00011062 |
| SMILES | [Ir] |
| Synonym | ion,black,metallicum,iridium, elemental,iridium, ion ir4,iridio,hydrido-iridium,atom,powder,sponge |
| IUPAC Name | iridium |
| InChI Key | GKOZUEZYRPOHIO-UHFFFAOYSA-N |
| Molecular Formula | Ir |
| Name Note | 1mm (0.039 in.) dia. |
|---|---|
| MDL Number | MFCD00678174 |
| Solubility Information | It is insoluble in water. |
| Chemical Name or Material | Steel shot |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
Sodium sulfate decahydrate, 99+%, for analysis
CAS: 7727-73-3 Molecular Formula: Na2O4S·10H2O Molecular Weight (g/mol): 322.2 InChI Key: RSIJVJUOQBWMIM-UHFFFAOYSA-L Synonym: sodium sulfate decahydrate,glauber's salt,disodium sulfate decahydrate,sodium sulfate usp,sulfuric acid disodium salt, decahydrate,unii-0ypr65r21j,sodium sulfate na2so4 decahydrate,sodium sulphate decahydrate,sodium sulfate decahydrate na2so4.10h2o,disodium sulfate decahydrate na2so4.10h2o PubChem CID: 62649 ChEBI: CHEBI:32586 IUPAC Name: disodium;sulfate;decahydrate SMILES: O.O.O.O.O.O.O.O.O.O.[O-]S(=O)(=O)[O-].[Na+].[Na+]
| PubChem CID | 62649 |
|---|---|
| CAS | 7727-73-3 |
| Molecular Weight (g/mol) | 322.2 |
| ChEBI | CHEBI:32586 |
| SMILES | O.O.O.O.O.O.O.O.O.O.[O-]S(=O)(=O)[O-].[Na+].[Na+] |
| Synonym | sodium sulfate decahydrate,glauber's salt,disodium sulfate decahydrate,sodium sulfate usp,sulfuric acid disodium salt, decahydrate,unii-0ypr65r21j,sodium sulfate na2so4 decahydrate,sodium sulphate decahydrate,sodium sulfate decahydrate na2so4.10h2o,disodium sulfate decahydrate na2so4.10h2o |
| IUPAC Name | disodium;sulfate;decahydrate |
| InChI Key | RSIJVJUOQBWMIM-UHFFFAOYSA-L |
| Molecular Formula | Na2O4S·10H2O |
Tin foil, 0.05mm (0.002in) thick, 99.999% (metals basis)
CAS: 7440-31-5 Molecular Formula: Sn Molecular Weight (g/mol): 118.71 MDL Number: MFCD00133862 InChI Key: ATJFFYVFTNAWJD-UHFFFAOYSA-N Synonym: powder,stannum,metallic,tin, elemental,wang,zinn,flake,tin, metal,silver matt powder,zinn german PubChem CID: 5352426 ChEBI: CHEBI:32990 IUPAC Name: tin SMILES: [Sn]
| PubChem CID | 5352426 |
|---|---|
| CAS | 7440-31-5 |
| Molecular Weight (g/mol) | 118.71 |
| ChEBI | CHEBI:32990 |
| MDL Number | MFCD00133862 |
| SMILES | [Sn] |
| Synonym | powder,stannum,metallic,tin, elemental,wang,zinn,flake,tin, metal,silver matt powder,zinn german |
| IUPAC Name | tin |
| InChI Key | ATJFFYVFTNAWJD-UHFFFAOYSA-N |
| Molecular Formula | Sn |
Potassium, chunks, in mineral oil, 98%
CAS: 9-7-7440 Molecular Formula: K Molecular Weight (g/mol): 39.10 MDL Number: MFCD00133776 InChI Key: ZLMJMSJWJFRBEC-UHFFFAOYSA-N Synonym: kalium,potassium, metal,potassium, liquid alloy,unii-rwp5ga015d,rwp5ga015d,hsdb 698,monopotassium,potasio,mono-potassium,atom PubChem CID: 5462222 ChEBI: CHEBI:26216 IUPAC Name: potassium SMILES: [K]
| PubChem CID | 5462222 |
|---|---|
| CAS | 9-7-7440 |
| Molecular Weight (g/mol) | 39.10 |
| ChEBI | CHEBI:26216 |
| MDL Number | MFCD00133776 |
| SMILES | [K] |
| Synonym | kalium,potassium, metal,potassium, liquid alloy,unii-rwp5ga015d,rwp5ga015d,hsdb 698,monopotassium,potasio,mono-potassium,atom |
| IUPAC Name | potassium |
| InChI Key | ZLMJMSJWJFRBEC-UHFFFAOYSA-N |
| Molecular Formula | K |
Aluminum oxide, activated, neutral, Brockmann Grade I, 58 angstroms
CAS: 1344-28-1 Molecular Formula: Al2O3 Molecular Weight (g/mol): 101.96 MDL Number: MFCD00003424 InChI Key: PNEYBMLMFCGWSK-UHFFFAOYSA-N Synonym: aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum PubChem CID: 9989226 SMILES: [O--].[O--].[O--].[Al+3].[Al+3]
| PubChem CID | 9989226 |
|---|---|
| CAS | 1344-28-1 |
| Molecular Weight (g/mol) | 101.96 |
| MDL Number | MFCD00003424 |
| SMILES | [O--].[O--].[O--].[Al+3].[Al+3] |
| Synonym | aluminum oxide,aluminum oxide,alpha-alumina,fasertonerde,abramant,abramax,abrarex,abrasit,aloxite,alundum |
| InChI Key | PNEYBMLMFCGWSK-UHFFFAOYSA-N |
| Molecular Formula | Al2O3 |
Scandium(III) nitrate hydrate, REacton™, 99.9% (REO)
CAS: 107552-14-7 Molecular Formula: N3O9Sc MDL Number: MFCD00011220 InChI Key: DFCYEXJMCFQPPA-UHFFFAOYSA-N Synonym: scandium nitrate,scandium iii nitrate,pa4cjgprtn,unii-pa4cjgprtn,scandium iii nitrate pentahydrate-sc reo,nitric acid, scandium 3+ salt 3:1,scandium 3+ trinitrate,acmc-1bol9,nitric acid, scandium salt PubChem CID: 166818 IUPAC Name: scandium(3+);trinitrate
| PubChem CID | 166818 |
|---|---|
| CAS | 107552-14-7 |
| MDL Number | MFCD00011220 |
| Synonym | scandium nitrate,scandium iii nitrate,pa4cjgprtn,unii-pa4cjgprtn,scandium iii nitrate pentahydrate-sc reo,nitric acid, scandium 3+ salt 3:1,scandium 3+ trinitrate,acmc-1bol9,nitric acid, scandium salt |
| IUPAC Name | scandium(3+);trinitrate |
| InChI Key | DFCYEXJMCFQPPA-UHFFFAOYSA-N |
| Molecular Formula | N3O9Sc |
Nickel wire, 0.025mm (0.001in) dia, hard, 99.98% (metals basis)
CAS: 7440-02-0 Molecular Formula: Ni Molecular Weight (g/mol): 58.69 MDL Number: MFCD00011137 MFCD06798735 InChI Key: PXHVJJICTQNCMI-UHFFFAOYSA-N Synonym: raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum PubChem CID: 935 ChEBI: CHEBI:28112 IUPAC Name: nickel SMILES: [Ni]
| PubChem CID | 935 |
|---|---|
| CAS | 7440-02-0 |
| Molecular Weight (g/mol) | 58.69 |
| ChEBI | CHEBI:28112 |
| MDL Number | MFCD00011137 MFCD06798735 |
| SMILES | [Ni] |
| Synonym | raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum |
| IUPAC Name | nickel |
| InChI Key | PXHVJJICTQNCMI-UHFFFAOYSA-N |
| Molecular Formula | Ni |
Copper wire, 1.0mm (0.04in) dia, annealed, 99.9% (metals basis)
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |